C32H25N3O5S2 — CID 9498208
(2S)-3-(1-benzofuran-2-carbonyl)-4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(4-prop-2-enoxyphenyl)-2H-pyrrol-5-one (PubChem CID 9498208) has the molecular formula C32H25N3O5S2 and a molecular weight of 595.70 g/mol. Its IUPAC name is (2S)-3-(1-benzofuran-2-carbonyl)-4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(4-prop-2-enoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | (2S)-3-(1-benzofuran-2-carbonyl)-4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(4-prop-2-enoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 9498208 |
| Molecular Formula | C32H25N3O5S2 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.12 |
| IUPAC Name | (2S)-3-(1-benzofuran-2-carbonyl)-4-hydroxy-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-(4-prop-2-enoxyphenyl)-2H-pyrrol-5-one |
| SMILES | C=CCOc1ccc([C@H]2C(C(=O)c3cc4ccccc4o3)=C(O)C(=O)N2c2nnc(SCc3ccc(C)cc3)s2)cc1 |
| InChI | InChI=1S/C32H25N3O5S2/c1-3-16-39-23-14-12-21(13-15-23)27-26(28(36)25-17-22-6-4-5-7-24(22)40-25)29(37)30(38)35(27)31-33-34-32(42-31)41-18-20-10-8-19(2)9-11-20/h3-15,17,27,37H,1,16,18H2,2H3/t27-/m0/s1 |
| InChIKey | QGPYLERAELMBOD-MHZLTWQESA-N |
| XLogP | 7.23 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|