C14H10F3N — CID 3306331
5,7-difluoro-2-(4-fluorophenyl)-2,3-dihydro-1H-indole (PubChem CID 3306331) has the molecular formula C14H10F3N and a molecular weight of 249.24 g/mol. Its IUPAC name is 5,7-difluoro-2-(4-fluorophenyl)-2,3-dihydro-1H-indole.
| Compound Name | 5,7-difluoro-2-(4-fluorophenyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 3306331 |
| Molecular Formula | C14H10F3N |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 5,7-difluoro-2-(4-fluorophenyl)-2,3-dihydro-1H-indole |
| SMILES | Fc1ccc(C2Cc3cc(F)cc(F)c3N2)cc1 |
| InChI | InChI=1S/C14H10F3N/c15-10-3-1-8(2-4-10)13-6-9-5-11(16)7-12(17)14(9)18-13/h1-5,7,13,18H,6H2 |
| InChIKey | BMTJKKMCXLIPEX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |