C41H47NO7S — CID 3306473
3-[[15,16-bis(4-hydroxybutyl)-12-methoxyimino-10-phenylsulfanyl-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-4-yl]oxy]benzaldehyde (PubChem CID 3306473) has the molecular formula C41H47NO7S and a molecular weight of 697.89 g/mol. Its IUPAC name is 3-[[15,16-bis(4-hydroxybutyl)-12-methoxyimino-10-phenylsulfanyl-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-4-yl]oxy]benzaldehyde.
| Compound Name | 3-[[15,16-bis(4-hydroxybutyl)-12-methoxyimino-10-phenylsulfanyl-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-4-yl]oxy]benzaldehyde |
|---|---|
| PubChem CID | 3306473 |
| Molecular Formula | C41H47NO7S |
| Molecular Weight | 697.89 g/mol |
| Exact Mass | 697.31 |
| IUPAC Name | 3-[[15,16-bis(4-hydroxybutyl)-12-methoxyimino-10-phenylsulfanyl-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-4-yl]oxy]benzaldehyde |
| SMILES | C=CCOC12Oc3ccc(Oc4cccc(C=O)c4)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOC)CC1Sc1ccccc1)C32 |
| InChI | InChI=1S/C41H47NO7S/c1-3-22-47-41-38(50-32-15-5-4-6-16-32)26-36(42-46-2)34-24-29(13-7-9-20-43)33(17-8-10-21-44)39(40(34)41)35-25-31(18-19-37(35)49-41)48-30-14-11-12-28(23-30)27-45/h3-6,11-12,14-16,18-19,23-25,27,29,33,38-40,43-44H,1,7-10,13,17,20-22,26H2,2H3 |
| InChIKey | ABWILQBGCWZNLN-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 106.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.89 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|