C38H49NO6S — CID 4272692
4-[12-ethoxyimino-16-(4-hydroxybutyl)-10-phenylsulfanyl-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-15-yl]butan-1-ol (PubChem CID 4272692) has the molecular formula C38H49NO6S and a molecular weight of 647.88 g/mol. Its IUPAC name is 4-[12-ethoxyimino-16-(4-hydroxybutyl)-10-phenylsulfanyl-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-15-yl]butan-1-ol.
| Compound Name | 4-[12-ethoxyimino-16-(4-hydroxybutyl)-10-phenylsulfanyl-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-15-yl]butan-1-ol |
|---|---|
| PubChem CID | 4272692 |
| Molecular Formula | C38H49NO6S |
| Molecular Weight | 647.88 g/mol |
| Exact Mass | 647.33 |
| IUPAC Name | 4-[12-ethoxyimino-16-(4-hydroxybutyl)-10-phenylsulfanyl-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-15-yl]butan-1-ol |
| SMILES | C=CCOc1ccc2c(c1)C1C(CCCCO)C(CCCCO)C=C3C(=NOCC)CC(Sc4ccccc4)C(OCC=C)(O2)C31 |
| InChI | InChI=1S/C38H49NO6S/c1-4-22-42-28-18-19-34-32(25-28)36-30(17-11-13-21-41)27(14-10-12-20-40)24-31-33(39-44-6-3)26-35(46-29-15-8-7-9-16-29)38(45-34,37(31)36)43-23-5-2/h4-5,7-9,15-16,18-19,24-25,27,30,35-37,40-41H,1-2,6,10-14,17,20-23,26H2,3H3 |
| InChIKey | NUQKSEAWSCECDW-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 89.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.88 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|