C35H45NO6S — CID 6627119
(1S,9S,10S,15R,16R,17S)-12-ethoxyimino-15,16-bis(4-hydroxybutyl)-10-phenylsulfanyl-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-4-ol (PubChem CID 6627119) has the molecular formula C35H45NO6S and a molecular weight of 607.81 g/mol. Its IUPAC name is (1S,9S,10S,15R,16R,17S)-12-ethoxyimino-15,16-bis(4-hydroxybutyl)-10-phenylsulfanyl-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-4-ol.
| Compound Name | (1S,9S,10S,15R,16R,17S)-12-ethoxyimino-15,16-bis(4-hydroxybutyl)-10-phenylsulfanyl-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-4-ol |
|---|---|
| PubChem CID | 6627119 |
| Molecular Formula | C35H45NO6S |
| Molecular Weight | 607.81 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | (1S,9S,10S,15R,16R,17S)-12-ethoxyimino-15,16-bis(4-hydroxybutyl)-10-phenylsulfanyl-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-4-ol |
| SMILES | C=CCO[C@@]12Oc3ccc(O)cc3[C@H]3[C@H](CCCCO)[C@@H](CCCCO)C=C(C(=NOCC)C[C@@H]1Sc1ccccc1)[C@H]32 |
| InChI | InChI=1S/C35H45NO6S/c1-3-20-40-35-32(43-26-13-6-5-7-14-26)23-30(36-41-4-2)28-21-24(12-8-10-18-37)27(15-9-11-19-38)33(34(28)35)29-22-25(39)16-17-31(29)42-35/h3,5-7,13-14,16-17,21-22,24,27,32-34,37-39H,1,4,8-12,15,18-20,23H2,2H3/t24-,27+,32-,33+,34+,35+/m0/s1 |
| InChIKey | AFLBCVPFXGMLQR-OOURHRGXSA-N |
| XLogP | 6.84 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.81 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|