C34H49NO6S — CID 5026036
4-[12-ethoxyimino-10-ethylsulfanyl-16-(4-hydroxybutyl)-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-15-yl]butan-1-ol (PubChem CID 5026036) has the molecular formula C34H49NO6S and a molecular weight of 599.83 g/mol. Its IUPAC name is 4-[12-ethoxyimino-10-ethylsulfanyl-16-(4-hydroxybutyl)-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-15-yl]butan-1-ol.
| Compound Name | 4-[12-ethoxyimino-10-ethylsulfanyl-16-(4-hydroxybutyl)-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-15-yl]butan-1-ol |
|---|---|
| PubChem CID | 5026036 |
| Molecular Formula | C34H49NO6S |
| Molecular Weight | 599.83 g/mol |
| Exact Mass | 599.33 |
| IUPAC Name | 4-[12-ethoxyimino-10-ethylsulfanyl-16-(4-hydroxybutyl)-4,9-bis(prop-2-enoxy)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-15-yl]butan-1-ol |
| SMILES | C=CCOc1ccc2c(c1)C1C(CCCCO)C(CCCCO)C=C3C(=NOCC)CC(SCC)C(OCC=C)(O2)C31 |
| InChI | InChI=1S/C34H49NO6S/c1-5-19-38-25-15-16-30-28(22-25)32-26(14-10-12-18-37)24(13-9-11-17-36)21-27-29(35-40-7-3)23-31(42-8-4)34(41-30,33(27)32)39-20-6-2/h5-6,15-16,21-22,24,26,31-33,36-37H,1-2,7-14,17-20,23H2,3-4H3 |
| InChIKey | JTGAGVXHHVMCIM-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 89.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.83 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|