C35H52N2O6S — CID 5108405
4-[4-[2-(aziridin-1-yl)ethoxy]-12-ethoxyimino-10-ethylsulfanyl-16-(4-hydroxybutyl)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-15-yl]butan-1-ol (PubChem CID 5108405) has the molecular formula C35H52N2O6S and a molecular weight of 628.88 g/mol. Its IUPAC name is 4-[4-[2-(aziridin-1-yl)ethoxy]-12-ethoxyimino-10-ethylsulfanyl-16-(4-hydroxybutyl)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-15-yl]butan-1-ol.
| Compound Name | 4-[4-[2-(aziridin-1-yl)ethoxy]-12-ethoxyimino-10-ethylsulfanyl-16-(4-hydroxybutyl)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-15-yl]butan-1-ol |
|---|---|
| PubChem CID | 5108405 |
| Molecular Formula | C35H52N2O6S |
| Molecular Weight | 628.88 g/mol |
| Exact Mass | 628.35 |
| IUPAC Name | 4-[4-[2-(aziridin-1-yl)ethoxy]-12-ethoxyimino-10-ethylsulfanyl-16-(4-hydroxybutyl)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-15-yl]butan-1-ol |
| SMILES | C=CCOC12Oc3ccc(OCCN4CC4)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOCC)CC1SCC)C32 |
| InChI | InChI=1S/C35H52N2O6S/c1-4-20-41-35-32(44-6-3)24-30(36-42-5-2)28-22-25(11-7-9-18-38)27(12-8-10-19-39)33(34(28)35)29-23-26(13-14-31(29)43-35)40-21-17-37-15-16-37/h4,13-14,22-23,25,27,32-34,38-39H,1,5-12,15-21,24H2,2-3H3 |
| InChIKey | BBEVIUBTRDLUMY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.88 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|