C40H49NO6S — CID 4540503
4-[10-ethylsulfanyl-16-(4-hydroxybutyl)-12-methoxyimino-4-naphthalen-2-yloxy-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-15-yl]butan-1-ol (PubChem CID 4540503) has the molecular formula C40H49NO6S and a molecular weight of 671.90 g/mol. Its IUPAC name is 4-[10-ethylsulfanyl-16-(4-hydroxybutyl)-12-methoxyimino-4-naphthalen-2-yloxy-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-15-yl]butan-1-ol.
| Compound Name | 4-[10-ethylsulfanyl-16-(4-hydroxybutyl)-12-methoxyimino-4-naphthalen-2-yloxy-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-15-yl]butan-1-ol |
|---|---|
| PubChem CID | 4540503 |
| Molecular Formula | C40H49NO6S |
| Molecular Weight | 671.90 g/mol |
| Exact Mass | 671.33 |
| IUPAC Name | 4-[10-ethylsulfanyl-16-(4-hydroxybutyl)-12-methoxyimino-4-naphthalen-2-yloxy-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-15-yl]butan-1-ol |
| SMILES | C=CCOC12Oc3ccc(Oc4ccc5ccccc5c4)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOC)CC1SCC)C32 |
| InChI | InChI=1S/C40H49NO6S/c1-4-22-45-40-37(48-5-2)26-35(41-44-3)33-24-29(14-8-10-20-42)32(15-9-11-21-43)38(39(33)40)34-25-31(18-19-36(34)47-40)46-30-17-16-27-12-6-7-13-28(27)23-30/h4,6-7,12-13,16-19,23-25,29,32,37-39,42-43H,1,5,8-11,14-15,20-22,26H2,2-3H3 |
| InChIKey | UNWQZTDALLWAIY-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 89.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.90 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|