C10H15N3S — CID 3306551
4-ethyl-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepine-2-thione (PubChem CID 3306551) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is 4-ethyl-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepine-2-thione.
| Compound Name | 4-ethyl-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepine-2-thione |
|---|---|
| PubChem CID | 3306551 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 4-ethyl-3,5,6,7,8,9-hexahydropyrimido[4,5-b]azepine-2-thione |
| SMILES | CCc1[nH]c(=S)nc2c1CCCCN2 |
| InChI | InChI=1S/C10H15N3S/c1-2-8-7-5-3-4-6-11-9(7)13-10(14)12-8/h2-6H2,1H3,(H2,11,12,13,14) |
| InChIKey | ZSAMXIZXKQCPHF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|