C19H19BrO4 — CID 3307502
(4-bromo-2,6-dimethylphenyl) 3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 3307502) has the molecular formula C19H19BrO4 and a molecular weight of 391.26 g/mol. Its IUPAC name is (4-bromo-2,6-dimethylphenyl) 3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (4-bromo-2,6-dimethylphenyl) 3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3307502 |
| Molecular Formula | C19H19BrO4 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | (4-bromo-2,6-dimethylphenyl) 3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)Oc2c(C)cc(Br)cc2C)cc1OC |
| InChI | InChI=1S/C19H19BrO4/c1-12-9-15(20)10-13(2)19(12)24-18(21)8-6-14-5-7-16(22-3)17(11-14)23-4/h5-11H,1-4H3 |
| InChIKey | YEKVNELHTDMBIO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|