C15H19N3O3 — CID 3315889
2-(1-aminobutyl)-N-(2-methoxyphenyl)-1,3-oxazole-4-carboxamide (PubChem CID 3315889) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-(1-aminobutyl)-N-(2-methoxyphenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(1-aminobutyl)-N-(2-methoxyphenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3315889 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-(1-aminobutyl)-N-(2-methoxyphenyl)-1,3-oxazole-4-carboxamide |
| SMILES | CCCC(N)c1nc(C(=O)Nc2ccccc2OC)co1 |
| InChI | InChI=1S/C15H19N3O3/c1-3-6-10(16)15-18-12(9-21-15)14(19)17-11-7-4-5-8-13(11)20-2/h4-5,7-10H,3,6,16H2,1-2H3,(H,17,19) |
| InChIKey | ZCMSZHGNQNREHK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |