C27H20N2O6 — CID 3316718
3-(1-benzofuran-2-carbonyl)-4-hydroxy-2-(3-nitrophenyl)-1-(2-phenylethyl)-2H-pyrrol-5-one (PubChem CID 3316718) has the molecular formula C27H20N2O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is 3-(1-benzofuran-2-carbonyl)-4-hydroxy-2-(3-nitrophenyl)-1-(2-phenylethyl)-2H-pyrrol-5-one.
| Compound Name | 3-(1-benzofuran-2-carbonyl)-4-hydroxy-2-(3-nitrophenyl)-1-(2-phenylethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3316718 |
| Molecular Formula | C27H20N2O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 3-(1-benzofuran-2-carbonyl)-4-hydroxy-2-(3-nitrophenyl)-1-(2-phenylethyl)-2H-pyrrol-5-one |
| SMILES | O=C(C1=C(O)C(=O)N(CCc2ccccc2)C1c1cccc([N+](=O)[O-])c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C27H20N2O6/c30-25(22-16-18-9-4-5-12-21(18)35-22)23-24(19-10-6-11-20(15-19)29(33)34)28(27(32)26(23)31)14-13-17-7-2-1-3-8-17/h1-12,15-16,24,31H,13-14H2 |
| InChIKey | RJRPFBNQKRKVKL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 113.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|