C25H30N4O3S — CID 3316782
tert-butyl 4-[4-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)-1,3-thiazol-2-yl]piperidine-1-carboxylate (PubChem CID 3316782) has the molecular formula C25H30N4O3S and a molecular weight of 466.61 g/mol. Its IUPAC name is tert-butyl 4-[4-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)-1,3-thiazol-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)-1,3-thiazol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3316782 |
| Molecular Formula | C25H30N4O3S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | tert-butyl 4-[4-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)-1,3-thiazol-2-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2nc(C(=O)N3CCc4c([nH]c5ccccc45)C3)cs2)CC1 |
| InChI | InChI=1S/C25H30N4O3S/c1-25(2,3)32-24(31)28-11-8-16(9-12-28)22-27-21(15-33-22)23(30)29-13-10-18-17-6-4-5-7-19(17)26-20(18)14-29/h4-7,15-16,26H,8-14H2,1-3H3 |
| InChIKey | CIWLRIDVBXFAJC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|