C30H21N3O4S2 — CID 3316802
14-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 3316802) has the molecular formula C30H21N3O4S2 and a molecular weight of 551.65 g/mol. Its IUPAC name is 14-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | 14-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 3316802 |
| Molecular Formula | C30H21N3O4S2 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | 14-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | Cc1c(-c2ccc(C=c3sc4n(c3=O)C(c3cccs3)C3=C(N=4)c4ccccc4CC3)o2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C30H21N3O4S2/c1-17-20(8-4-9-23(17)33(35)36)24-14-12-19(37-24)16-26-29(34)32-28(25-10-5-15-38-25)22-13-11-18-6-2-3-7-21(18)27(22)31-30(32)39-26/h2-10,12,14-16,28H,11,13H2,1H3 |
| InChIKey | DIVQYLRIROALKE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 90.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|