C22H23N3O2 — CID 3318707
2-(1,2-dimethylindol-3-yl)-N-(4-methylphenyl)-2-(2-oxoazetidin-1-yl)acetamide (PubChem CID 3318707) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 2-(1,2-dimethylindol-3-yl)-N-(4-methylphenyl)-2-(2-oxoazetidin-1-yl)acetamide.
| Compound Name | 2-(1,2-dimethylindol-3-yl)-N-(4-methylphenyl)-2-(2-oxoazetidin-1-yl)acetamide |
|---|---|
| PubChem CID | 3318707 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2-(1,2-dimethylindol-3-yl)-N-(4-methylphenyl)-2-(2-oxoazetidin-1-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)C(c2c(C)n(C)c3ccccc23)N2CCC2=O)cc1 |
| InChI | InChI=1S/C22H23N3O2/c1-14-8-10-16(11-9-14)23-22(27)21(25-13-12-19(25)26)20-15(2)24(3)18-7-5-4-6-17(18)20/h4-11,21H,12-13H2,1-3H3,(H,23,27) |
| InChIKey | HQJLXTYZSNHPEJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|