C14H14F3NO2 — CID 75530069
methyl 2-(1,2-dimethylindol-3-yl)-3,3,3-trifluoropropanoate (PubChem CID 75530069) has the molecular formula C14H14F3NO2 and a molecular weight of 285.26 g/mol. Its IUPAC name is methyl 2-(1,2-dimethylindol-3-yl)-3,3,3-trifluoropropanoate.
| Compound Name | methyl 2-(1,2-dimethylindol-3-yl)-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 75530069 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | methyl 2-(1,2-dimethylindol-3-yl)-3,3,3-trifluoropropanoate |
| SMILES | COC(=O)C(c1c(C)n(C)c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C14H14F3NO2/c1-8-11(12(13(19)20-3)14(15,16)17)9-6-4-5-7-10(9)18(8)2/h4-7,12H,1-3H3 |
| InChIKey | JTHWOYJZHWRVCG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|