C23H26N2O4 — CID 14152083
methyl (2R,3R)-3-(1,2-dimethylindol-3-yl)-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 14152083) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is methyl (2R,3R)-3-(1,2-dimethylindol-3-yl)-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | methyl (2R,3R)-3-(1,2-dimethylindol-3-yl)-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 14152083 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | methyl (2R,3R)-3-(1,2-dimethylindol-3-yl)-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COC(=O)[C@H](NC(=O)OCc1ccccc1)[C@H](C)c1c(C)n(C)c2ccccc12 |
| InChI | InChI=1S/C23H26N2O4/c1-15(20-16(2)25(3)19-13-9-8-12-18(19)20)21(22(26)28-4)24-23(27)29-14-17-10-6-5-7-11-17/h5-13,15,21H,14H2,1-4H3,(H,24,27)/t15-,21-/m1/s1 |
| InChIKey | ISUQVJKBDXFUAE-QVKFZJNVSA-N |
| XLogP | 4.06 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|