C26H31ClN2O4 — CID 14152071
methyl (2R,3R)-3-(1-butyl-5-chloro-2-methylindol-3-yl)-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 14152071) has the molecular formula C26H31ClN2O4 and a molecular weight of 471.00 g/mol. Its IUPAC name is methyl (2R,3R)-3-(1-butyl-5-chloro-2-methylindol-3-yl)-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | methyl (2R,3R)-3-(1-butyl-5-chloro-2-methylindol-3-yl)-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 14152071 |
| Molecular Formula | C26H31ClN2O4 |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | methyl (2R,3R)-3-(1-butyl-5-chloro-2-methylindol-3-yl)-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CCCCn1c(C)c([C@@H](C)[C@@H](NC(=O)OCc2ccccc2)C(=O)OC)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C26H31ClN2O4/c1-5-6-14-29-18(3)23(21-15-20(27)12-13-22(21)29)17(2)24(25(30)32-4)28-26(31)33-16-19-10-8-7-9-11-19/h7-13,15,17,24H,5-6,14,16H2,1-4H3,(H,28,31)/t17-,24-/m1/s1 |
| InChIKey | JKAZWVFAHNBFJZ-MZNJEOGPSA-N |
| XLogP | 5.97 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|