C17H18N4 — CID 3319619
2-[5,5-dimethyl-3-(pyridin-3-ylmethylamino)cyclohex-2-en-1-ylidene]propanedinitrile (PubChem CID 3319619) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-[5,5-dimethyl-3-(pyridin-3-ylmethylamino)cyclohex-2-en-1-ylidene]propanedinitrile.
| Compound Name | 2-[5,5-dimethyl-3-(pyridin-3-ylmethylamino)cyclohex-2-en-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 3319619 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-[5,5-dimethyl-3-(pyridin-3-ylmethylamino)cyclohex-2-en-1-ylidene]propanedinitrile |
| SMILES | CC1(C)CC(NCc2cccnc2)=CC(=C(C#N)C#N)C1 |
| InChI | InChI=1S/C17H18N4/c1-17(2)7-14(15(9-18)10-19)6-16(8-17)21-12-13-4-3-5-20-11-13/h3-6,11,21H,7-8,12H2,1-2H3 |
| InChIKey | UVKMQLSIXWKYTK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|