C19H26Cl2N2O5S — CID 3323439
[2-(azepan-1-yl)-2-oxoethyl] 2,4-dichloro-5-(2-methylpropylsulfamoyl)benzoate (PubChem CID 3323439) has the molecular formula C19H26Cl2N2O5S and a molecular weight of 465.40 g/mol. Its IUPAC name is [2-(azepan-1-yl)-2-oxoethyl] 2,4-dichloro-5-(2-methylpropylsulfamoyl)benzoate.
| Compound Name | [2-(azepan-1-yl)-2-oxoethyl] 2,4-dichloro-5-(2-methylpropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 3323439 |
| Molecular Formula | C19H26Cl2N2O5S |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | [2-(azepan-1-yl)-2-oxoethyl] 2,4-dichloro-5-(2-methylpropylsulfamoyl)benzoate |
| SMILES | CC(C)CNS(=O)(=O)c1cc(C(=O)OCC(=O)N2CCCCCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H26Cl2N2O5S/c1-13(2)11-22-29(26,27)17-9-14(15(20)10-16(17)21)19(25)28-12-18(24)23-7-5-3-4-6-8-23/h9-10,13,22H,3-8,11-12H2,1-2H3 |
| InChIKey | USPKYDKREBEYIK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |