C19H20Cl2FNO5S — CID 3281328
2-(2-fluorophenoxy)ethyl 2,4-dichloro-5-(2-methylpropylsulfamoyl)benzoate (PubChem CID 3281328) has the molecular formula C19H20Cl2FNO5S and a molecular weight of 464.34 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)ethyl 2,4-dichloro-5-(2-methylpropylsulfamoyl)benzoate.
| Compound Name | 2-(2-fluorophenoxy)ethyl 2,4-dichloro-5-(2-methylpropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 3281328 |
| Molecular Formula | C19H20Cl2FNO5S |
| Molecular Weight | 464.34 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 2-(2-fluorophenoxy)ethyl 2,4-dichloro-5-(2-methylpropylsulfamoyl)benzoate |
| SMILES | CC(C)CNS(=O)(=O)c1cc(C(=O)OCCOc2ccccc2F)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl2FNO5S/c1-12(2)11-23-29(25,26)18-9-13(14(20)10-15(18)21)19(24)28-8-7-27-17-6-4-3-5-16(17)22/h3-6,9-10,12,23H,7-8,11H2,1-2H3 |
| InChIKey | UFQVUEJLANBVEE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|