C24H32N3O3+ — CID 3324481
benzyl-butyl-[3-[[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]propyl]azanium (PubChem CID 3324481) has the molecular formula C24H32N3O3+ and a molecular weight of 410.54 g/mol. Its IUPAC name is benzyl-butyl-[3-[[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]propyl]azanium.
| Compound Name | benzyl-butyl-[3-[[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 3324481 |
| Molecular Formula | C24H32N3O3+ |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | benzyl-butyl-[3-[[2-(3-oxo-1,4-benzoxazin-4-yl)acetyl]amino]propyl]azanium |
| SMILES | CCCC[NH+](CCCNC(=O)CN1C(=O)COc2ccccc21)Cc1ccccc1 |
| InChI | InChI=1S/C24H31N3O3/c1-2-3-15-26(17-20-10-5-4-6-11-20)16-9-14-25-23(28)18-27-21-12-7-8-13-22(21)30-19-24(27)29/h4-8,10-13H,2-3,9,14-19H2,1H3,(H,25,28)/p+1 |
| InChIKey | KIMHQMAUFPDLKS-UHFFFAOYSA-O |
| XLogP | 1.80 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|