C16H23N2O3+ — CID 3324672
[2-(4-butyl-2-methyl-5-oxooxolan-2-yl)-2-oxoethyl]-pyridin-2-ylazanium (PubChem CID 3324672) has the molecular formula C16H23N2O3+ and a molecular weight of 291.37 g/mol. Its IUPAC name is [2-(4-butyl-2-methyl-5-oxooxolan-2-yl)-2-oxoethyl]-pyridin-2-ylazanium.
| Compound Name | [2-(4-butyl-2-methyl-5-oxooxolan-2-yl)-2-oxoethyl]-pyridin-2-ylazanium |
|---|---|
| PubChem CID | 3324672 |
| Molecular Formula | C16H23N2O3+ |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | [2-(4-butyl-2-methyl-5-oxooxolan-2-yl)-2-oxoethyl]-pyridin-2-ylazanium |
| SMILES | CCCCC1CC(C)(C(=O)C[NH2+]c2ccccn2)OC1=O |
| InChI | InChI=1S/C16H22N2O3/c1-3-4-7-12-10-16(2,21-15(12)20)13(19)11-18-14-8-5-6-9-17-14/h5-6,8-9,12H,3-4,7,10-11H2,1-2H3,(H,17,18)/p+1 |
| InChIKey | ITNZGHQODGRHAV-UHFFFAOYSA-O |
| XLogP | 1.36 |
| TPSA | 72.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |