C20H26N2O2 — CID 134824203
ethyl 6-[(3-methyl-2-pyridinyl)amino]-6-phenylhexanoate (PubChem CID 134824203) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is ethyl 6-[(3-methyl-2-pyridinyl)amino]-6-phenylhexanoate.
| Compound Name | ethyl 6-[(3-methyl-2-pyridinyl)amino]-6-phenylhexanoate |
|---|---|
| PubChem CID | 134824203 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | ethyl 6-[(3-methyl-2-pyridinyl)amino]-6-phenylhexanoate |
| SMILES | CCOC(=O)CCCCC(Nc1ncccc1C)c1ccccc1 |
| InChI | InChI=1S/C20H26N2O2/c1-3-24-19(23)14-8-7-13-18(17-11-5-4-6-12-17)22-20-16(2)10-9-15-21-20/h4-6,9-12,15,18H,3,7-8,13-14H2,1-2H3,(H,21,22) |
| InChIKey | MFKDRKAQSMEYOI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|