C20H17N3O4 — CID 33269667
(3R)-3'-[2-(2-oxo-1,3-benzoxazol-3-yl)ethyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 33269667) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is (3R)-3'-[2-(2-oxo-1,3-benzoxazol-3-yl)ethyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | (3R)-3'-[2-(2-oxo-1,3-benzoxazol-3-yl)ethyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 33269667 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (3R)-3'-[2-(2-oxo-1,3-benzoxazol-3-yl)ethyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1N[C@@]2(CCc3ccccc32)C(=O)N1CCn1c(=O)oc2ccccc21 |
| InChI | InChI=1S/C20H17N3O4/c24-17-20(10-9-13-5-1-2-6-14(13)20)21-18(25)23(17)12-11-22-15-7-3-4-8-16(15)27-19(22)26/h1-8H,9-12H2,(H,21,25)/t20-/m1/s1 |
| InChIKey | SRLHYRIRTAKUQN-HXUWFJFHSA-N |
| XLogP | 1.99 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|