C16H28N2O2+2 — CID 3327362
[1-[3-(4-methylpiperazine-1,4-diium-1-yl)prop-1-ynyl]cyclohexyl] acetate (PubChem CID 3327362) has the molecular formula C16H28N2O2+2 and a molecular weight of 280.41 g/mol. Its IUPAC name is [1-[3-(4-methylpiperazine-1,4-diium-1-yl)prop-1-ynyl]cyclohexyl] acetate.
| Compound Name | [1-[3-(4-methylpiperazine-1,4-diium-1-yl)prop-1-ynyl]cyclohexyl] acetate |
|---|---|
| PubChem CID | 3327362 |
| Molecular Formula | C16H28N2O2+2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.21 |
| IUPAC Name | [1-[3-(4-methylpiperazine-1,4-diium-1-yl)prop-1-ynyl]cyclohexyl] acetate |
| SMILES | CC(=O)OC1(C#CC[NH+]2CC[NH+](C)CC2)CCCCC1 |
| InChI | InChI=1S/C16H26N2O2/c1-15(19)20-16(7-4-3-5-8-16)9-6-10-18-13-11-17(2)12-14-18/h3-5,7-8,10-14H2,1-2H3/p+2 |
| InChIKey | JMOGRRAUCBZNAV-UHFFFAOYSA-P |
| XLogP | -1.33 |
| TPSA | 35.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|