C27H31NO4S — CID 53381148
[1-[3-[(4-methylphenyl)sulfonyl-[(E)-3-phenylprop-2-enyl]amino]prop-1-ynyl]cyclohexyl] acetate (PubChem CID 53381148) has the molecular formula C27H31NO4S and a molecular weight of 465.62 g/mol. Its IUPAC name is [1-[3-[(4-methylphenyl)sulfonyl-[(E)-3-phenylprop-2-enyl]amino]prop-1-ynyl]cyclohexyl] acetate.
| Compound Name | [1-[3-[(4-methylphenyl)sulfonyl-[(E)-3-phenylprop-2-enyl]amino]prop-1-ynyl]cyclohexyl] acetate |
|---|---|
| PubChem CID | 53381148 |
| Molecular Formula | C27H31NO4S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | [1-[3-[(4-methylphenyl)sulfonyl-[(E)-3-phenylprop-2-enyl]amino]prop-1-ynyl]cyclohexyl] acetate |
| SMILES | CC(=O)OC1(C#CCN(C/C=C/c2ccccc2)S(=O)(=O)c2ccc(C)cc2)CCCCC1 |
| InChI | InChI=1S/C27H31NO4S/c1-23-14-16-26(17-15-23)33(30,31)28(21-9-13-25-11-5-3-6-12-25)22-10-20-27(32-24(2)29)18-7-4-8-19-27/h3,5-6,9,11-17H,4,7-8,18-19,21-22H2,1-2H3/b13-9+ |
| InChIKey | MZZKMVLDWDIZGB-UKTHLTGXSA-N |
| XLogP | 4.97 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|