C23H29NO8 — CID 3328543
3-O,3-O'-diethyl 1-O-methyl 2-(3,3-diethoxyprop-1-ynyl)-2H-indole-1,3,3-tricarboxylate (PubChem CID 3328543) has the molecular formula C23H29NO8 and a molecular weight of 447.48 g/mol. Its IUPAC name is 3-O,3-O'-diethyl 1-O-methyl 2-(3,3-diethoxyprop-1-ynyl)-2H-indole-1,3,3-tricarboxylate.
| Compound Name | 3-O,3-O'-diethyl 1-O-methyl 2-(3,3-diethoxyprop-1-ynyl)-2H-indole-1,3,3-tricarboxylate |
|---|---|
| PubChem CID | 3328543 |
| Molecular Formula | C23H29NO8 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 3-O,3-O'-diethyl 1-O-methyl 2-(3,3-diethoxyprop-1-ynyl)-2H-indole-1,3,3-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)c2ccccc2N(C(=O)OC)C1C#CC(OCC)OCC |
| InChI | InChI=1S/C23H29NO8/c1-6-29-19(30-7-2)15-14-18-23(20(25)31-8-3,21(26)32-9-4)16-12-10-11-13-17(16)24(18)22(27)28-5/h10-13,18-19H,6-9H2,1-5H3 |
| InChIKey | YXJCROKKJBPDND-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|