C22H22ClN3O2 — CID 33290510
N-[2-(3-chloroanilino)-2-oxoethyl]-N-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 33290510) has the molecular formula C22H22ClN3O2 and a molecular weight of 395.89 g/mol. Its IUPAC name is N-[2-(3-chloroanilino)-2-oxoethyl]-N-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | N-[2-(3-chloroanilino)-2-oxoethyl]-N-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 33290510 |
| Molecular Formula | C22H22ClN3O2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-[2-(3-chloroanilino)-2-oxoethyl]-N-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | CN(CC(=O)Nc1cccc(Cl)c1)C(=O)c1cccc2c3c([nH]c12)CCCC3 |
| InChI | InChI=1S/C22H22ClN3O2/c1-26(13-20(27)24-15-7-4-6-14(23)12-15)22(28)18-10-5-9-17-16-8-2-3-11-19(16)25-21(17)18/h4-7,9-10,12,25H,2-3,8,11,13H2,1H3,(H,24,27) |
| InChIKey | ZORWTXNOBAKMEL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|