C23H23N3O4 — CID 45341046
2-[[2-[methyl(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)amino]acetyl]amino]benzoic acid (PubChem CID 45341046) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is 2-[[2-[methyl(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)amino]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[methyl(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)amino]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 45341046 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-[[2-[methyl(6,7,8,9-tetrahydro-5H-carbazole-3-carbonyl)amino]acetyl]amino]benzoic acid |
| SMILES | CN(CC(=O)Nc1ccccc1C(=O)O)C(=O)c1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C23H23N3O4/c1-26(13-21(27)25-19-9-5-3-7-16(19)23(29)30)22(28)14-10-11-20-17(12-14)15-6-2-4-8-18(15)24-20/h3,5,7,9-12,24H,2,4,6,8,13H2,1H3,(H,25,27)(H,29,30) |
| InChIKey | XIICZCGAQWONPH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|