C21H27N3O8 — CID 33294815
4-O-[2-[(3-tert-butyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 3-O,5-O-dimethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate (PubChem CID 33294815) has the molecular formula C21H27N3O8 and a molecular weight of 449.46 g/mol. Its IUPAC name is 4-O-[2-[(3-tert-butyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 3-O,5-O-dimethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate.
| Compound Name | 4-O-[2-[(3-tert-butyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 3-O,5-O-dimethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 33294815 |
| Molecular Formula | C21H27N3O8 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 4-O-[2-[(3-tert-butyl-1,2-oxazol-5-yl)amino]-2-oxoethyl] 3-O,5-O-dimethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C(=O)OCC(=O)Nc1cc(C(C)(C)C)no1 |
| InChI | InChI=1S/C21H27N3O8/c1-10-15(18(26)29-6)17(16(11(2)22-10)19(27)30-7)20(28)31-9-13(25)23-14-8-12(24-32-14)21(3,4)5/h8,17,22H,9H2,1-7H3,(H,23,25) |
| InChIKey | PCNCUPMQPUDSPE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 146.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|