C18H24N2O2 — CID 3330174
2-(cyclopenten-1-yloxy)-N'-[1-(4-methylphenyl)but-1-enyl]acetohydrazide (PubChem CID 3330174) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-(cyclopenten-1-yloxy)-N'-[1-(4-methylphenyl)but-1-enyl]acetohydrazide.
| Compound Name | 2-(cyclopenten-1-yloxy)-N'-[1-(4-methylphenyl)but-1-enyl]acetohydrazide |
|---|---|
| PubChem CID | 3330174 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-(cyclopenten-1-yloxy)-N'-[1-(4-methylphenyl)but-1-enyl]acetohydrazide |
| SMILES | CCC=C(NNC(=O)COC1=CCCC1)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H24N2O2/c1-3-6-17(15-11-9-14(2)10-12-15)19-20-18(21)13-22-16-7-4-5-8-16/h6-7,9-12,19H,3-5,8,13H2,1-2H3,(H,20,21) |
| InChIKey | YZUBUWVXOVWRMG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|