C15H17BrN2O2 — CID 4130442
N'-[1-(4-bromophenyl)ethenyl]-2-(cyclopenten-1-yloxy)acetohydrazide (PubChem CID 4130442) has the molecular formula C15H17BrN2O2 and a molecular weight of 337.22 g/mol. Its IUPAC name is N'-[1-(4-bromophenyl)ethenyl]-2-(cyclopenten-1-yloxy)acetohydrazide.
| Compound Name | N'-[1-(4-bromophenyl)ethenyl]-2-(cyclopenten-1-yloxy)acetohydrazide |
|---|---|
| PubChem CID | 4130442 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | N'-[1-(4-bromophenyl)ethenyl]-2-(cyclopenten-1-yloxy)acetohydrazide |
| SMILES | C=C(NNC(=O)COC1=CCCC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H17BrN2O2/c1-11(12-6-8-13(16)9-7-12)17-18-15(19)10-20-14-4-2-3-5-14/h4,6-9,17H,1-3,5,10H2,(H,18,19) |
| InChIKey | QNWVFOLCRHINLI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|