C16H14ClF3N2O4S — CID 33318448
(6-chloro-3-pyridinyl)methyl 3-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanoate (PubChem CID 33318448) has the molecular formula C16H14ClF3N2O4S and a molecular weight of 422.81 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methyl 3-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanoate.
| Compound Name | (6-chloro-3-pyridinyl)methyl 3-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 33318448 |
| Molecular Formula | C16H14ClF3N2O4S |
| Molecular Weight | 422.81 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | (6-chloro-3-pyridinyl)methyl 3-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanoate |
| SMILES | O=C(CCNS(=O)(=O)c1ccccc1C(F)(F)F)OCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H14ClF3N2O4S/c17-14-6-5-11(9-21-14)10-26-15(23)7-8-22-27(24,25)13-4-2-1-3-12(13)16(18,19)20/h1-6,9,22H,7-8,10H2 |
| InChIKey | COIMJMGGQYWNIQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.81 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|