C19H18N2O3S — CID 33331086
2,5-dioxo-N-(2-prop-2-enylsulfanylphenyl)-1,6,7,8-tetrahydroquinoline-3-carboxamide (PubChem CID 33331086) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is 2,5-dioxo-N-(2-prop-2-enylsulfanylphenyl)-1,6,7,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | 2,5-dioxo-N-(2-prop-2-enylsulfanylphenyl)-1,6,7,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 33331086 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2,5-dioxo-N-(2-prop-2-enylsulfanylphenyl)-1,6,7,8-tetrahydroquinoline-3-carboxamide |
| SMILES | C=CCSc1ccccc1NC(=O)c1cc2c([nH]c1=O)CCCC2=O |
| InChI | InChI=1S/C19H18N2O3S/c1-2-10-25-17-9-4-3-6-15(17)21-19(24)13-11-12-14(20-18(13)23)7-5-8-16(12)22/h2-4,6,9,11H,1,5,7-8,10H2,(H,20,23)(H,21,24) |
| InChIKey | QNHYUQCZTLRPTQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|