C9H18OSi2 — CID 3339427
1,3-bis(trimethylsilyl)prop-2-yn-1-one (PubChem CID 3339427) has the molecular formula C9H18OSi2 and a molecular weight of 198.41 g/mol. Its IUPAC name is 1,3-bis(trimethylsilyl)prop-2-yn-1-one.
| Compound Name | 1,3-bis(trimethylsilyl)prop-2-yn-1-one |
|---|---|
| PubChem CID | 3339427 |
| Molecular Formula | C9H18OSi2 |
| Molecular Weight | 198.41 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1,3-bis(trimethylsilyl)prop-2-yn-1-one |
| SMILES | C[Si](C)(C)C#CC(=O)[Si](C)(C)C |
| InChI | InChI=1S/C9H18OSi2/c1-11(2,3)8-7-9(10)12(4,5)6/h1-6H3 |
| InChIKey | REYMYRJIMLRGCP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|