C21H23N3O4S — CID 33449264
(E)-3-(1,3-benzoxazol-2-yl)-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]prop-2-enamide (PubChem CID 33449264) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 33449264 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-N-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]prop-2-enamide |
| SMILES | CC(C)NS(=O)(=O)Cc1ccccc1CNC(=O)/C=C/c1nc2ccccc2o1 |
| InChI | InChI=1S/C21H23N3O4S/c1-15(2)24-29(26,27)14-17-8-4-3-7-16(17)13-22-20(25)11-12-21-23-18-9-5-6-10-19(18)28-21/h3-12,15,24H,13-14H2,1-2H3,(H,22,25)/b12-11+ |
| InChIKey | MJYGLIVMWXJYPL-VAWYXSNFSA-N |
| XLogP | 2.99 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|