C17H23NO2 — CID 3345954
8a-methyl-3-prop-1-en-2-ylspiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-1,3-dioxolane]-1-carbonitrile (PubChem CID 3345954) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 8a-methyl-3-prop-1-en-2-ylspiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-1,3-dioxolane]-1-carbonitrile.
| Compound Name | 8a-methyl-3-prop-1-en-2-ylspiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-1,3-dioxolane]-1-carbonitrile |
|---|---|
| PubChem CID | 3345954 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 8a-methyl-3-prop-1-en-2-ylspiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-1,3-dioxolane]-1-carbonitrile |
| SMILES | C=C(C)C1C=C2CC3(CCC2(C)C(C#N)C1)OCCO3 |
| InChI | InChI=1S/C17H23NO2/c1-12(2)13-8-14-10-17(19-6-7-20-17)5-4-16(14,3)15(9-13)11-18/h8,13,15H,1,4-7,9-10H2,2-3H3 |
| InChIKey | VHVPWZSMFUDSIL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|