C19H24N4O2S2 — CID 3346670
6-(diethylamino)-1,4-dimethyl-2-oxo-5-[(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile (PubChem CID 3346670) has the molecular formula C19H24N4O2S2 and a molecular weight of 404.56 g/mol. Its IUPAC name is 6-(diethylamino)-1,4-dimethyl-2-oxo-5-[(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile.
| Compound Name | 6-(diethylamino)-1,4-dimethyl-2-oxo-5-[(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3346670 |
| Molecular Formula | C19H24N4O2S2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 6-(diethylamino)-1,4-dimethyl-2-oxo-5-[(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile |
| SMILES | CCCN1C(=O)C(=Cc2c(C)c(C#N)c(=O)n(C)c2N(CC)CC)SC1=S |
| InChI | InChI=1S/C19H24N4O2S2/c1-6-9-23-18(25)15(27-19(23)26)10-13-12(4)14(11-20)17(24)21(5)16(13)22(7-2)8-3/h10H,6-9H2,1-5H3 |
| InChIKey | FAUVMDJZUWQPJY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|