C21H28N4O2S2 — CID 3363348
5-[(3-butan-2-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(diethylamino)-1-ethyl-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 3363348) has the molecular formula C21H28N4O2S2 and a molecular weight of 432.62 g/mol. Its IUPAC name is 5-[(3-butan-2-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(diethylamino)-1-ethyl-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(3-butan-2-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(diethylamino)-1-ethyl-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3363348 |
| Molecular Formula | C21H28N4O2S2 |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 5-[(3-butan-2-yl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(diethylamino)-1-ethyl-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCC(C)N1C(=O)C(=Cc2c(C)c(C#N)c(=O)n(CC)c2N(CC)CC)SC1=S |
| InChI | InChI=1S/C21H28N4O2S2/c1-7-13(5)25-20(27)17(29-21(25)28)11-15-14(6)16(12-22)19(26)24(10-4)18(15)23(8-2)9-3/h11,13H,7-10H2,1-6H3 |
| InChIKey | ZWPTVJUAJHAHFZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|