C21H28N4O3S2 — CID 3346828
6-(diethylamino)-5-[[3-(3-ethoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-2-oxopyridine-3-carbonitrile (PubChem CID 3346828) has the molecular formula C21H28N4O3S2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 6-(diethylamino)-5-[[3-(3-ethoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 6-(diethylamino)-5-[[3-(3-ethoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3346828 |
| Molecular Formula | C21H28N4O3S2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 6-(diethylamino)-5-[[3-(3-ethoxypropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCOCCCN1C(=O)C(=Cc2c(C)c(C#N)c(=O)n(C)c2N(CC)CC)SC1=S |
| InChI | InChI=1S/C21H28N4O3S2/c1-6-24(7-2)18-15(14(4)16(13-22)19(26)23(18)5)12-17-20(27)25(21(29)30-17)10-9-11-28-8-3/h12H,6-11H2,1-5H3 |
| InChIKey | LJWJBQVHVPECPT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|