C27H25BrN2O6 — CID 3347590
5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-(3-propoxyphenyl)methylidene]-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 3347590) has the molecular formula C27H25BrN2O6 and a molecular weight of 553.41 g/mol. Its IUPAC name is 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-(3-propoxyphenyl)methylidene]-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-(3-propoxyphenyl)methylidene]-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3347590 |
| Molecular Formula | C27H25BrN2O6 |
| Molecular Weight | 553.41 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-(3-propoxyphenyl)methylidene]-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | CCCOc1cccc(C(O)=C2C(=O)C(=O)N(Cc3ccncc3)C2c2cc(Br)c(O)c(OC)c2)c1 |
| InChI | InChI=1S/C27H25BrN2O6/c1-3-11-36-19-6-4-5-17(12-19)24(31)22-23(18-13-20(28)25(32)21(14-18)35-2)30(27(34)26(22)33)15-16-7-9-29-10-8-16/h4-10,12-14,23,31-32H,3,11,15H2,1-2H3 |
| InChIKey | AKUUTDIAZPZDOJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|