C25H29BrN2O6 — CID 6170832
(4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-[2-(dimethylamino)ethyl]-4-[hydroxy-(3-propoxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 6170832) has the molecular formula C25H29BrN2O6 and a molecular weight of 533.42 g/mol. Its IUPAC name is (4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-[2-(dimethylamino)ethyl]-4-[hydroxy-(3-propoxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-[2-(dimethylamino)ethyl]-4-[hydroxy-(3-propoxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6170832 |
| Molecular Formula | C25H29BrN2O6 |
| Molecular Weight | 533.42 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | (4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-[2-(dimethylamino)ethyl]-4-[hydroxy-(3-propoxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCCOc1cccc(/C(O)=C2\C(=O)C(=O)N(CCN(C)C)C2c2cc(Br)c(O)c(OC)c2)c1 |
| InChI | InChI=1S/C25H29BrN2O6/c1-5-11-34-17-8-6-7-15(12-17)22(29)20-21(16-13-18(26)23(30)19(14-16)33-4)28(10-9-27(2)3)25(32)24(20)31/h6-8,12-14,21,29-30H,5,9-11H2,1-4H3/b22-20+ |
| InChIKey | ORXJSNKZLKNJDL-LSDHQDQOSA-N |
| XLogP | 3.94 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|