C24H27BrN2O6 — CID 6170689
(4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-[2-(dimethylamino)ethyl]-4-[(3-ethoxyphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione (PubChem CID 6170689) has the molecular formula C24H27BrN2O6 and a molecular weight of 519.39 g/mol. Its IUPAC name is (4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-[2-(dimethylamino)ethyl]-4-[(3-ethoxyphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-[2-(dimethylamino)ethyl]-4-[(3-ethoxyphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6170689 |
| Molecular Formula | C24H27BrN2O6 |
| Molecular Weight | 519.39 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | (4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-[2-(dimethylamino)ethyl]-4-[(3-ethoxyphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
| SMILES | CCOc1cccc(/C(O)=C2\C(=O)C(=O)N(CCN(C)C)C2c2cc(Br)c(O)c(OC)c2)c1 |
| InChI | InChI=1S/C24H27BrN2O6/c1-5-33-16-8-6-7-14(11-16)21(28)19-20(15-12-17(25)22(29)18(13-15)32-4)27(10-9-26(2)3)24(31)23(19)30/h6-8,11-13,20,28-29H,5,9-10H2,1-4H3/b21-19+ |
| InChIKey | KXKGXRCYMDTMDI-XUTLUUPISA-N |
| XLogP | 3.55 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|