C24H27BrN2O7 — CID 3506809
5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]pyrrolidine-2,3-dione (PubChem CID 3506809) has the molecular formula C24H27BrN2O7 and a molecular weight of 535.39 g/mol. Its IUPAC name is 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]pyrrolidine-2,3-dione.
| Compound Name | 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3506809 |
| Molecular Formula | C24H27BrN2O7 |
| Molecular Weight | 535.39 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(O)=C2C(=O)C(=O)N(CCN(C)C)C2c2cc(Br)c(O)c(OC)c2)cc1OC |
| InChI | InChI=1S/C24H27BrN2O7/c1-26(2)8-9-27-20(14-10-15(25)22(29)18(12-14)34-5)19(23(30)24(27)31)21(28)13-6-7-16(32-3)17(11-13)33-4/h6-7,10-12,20,28-29H,8-9H2,1-5H3 |
| InChIKey | HDDIUOXLXHGPJO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|