C29H37BrN2O6 — CID 5118200
5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[(3-butoxyphenyl)-hydroxymethylidene]-1-[3-(diethylamino)propyl]pyrrolidine-2,3-dione (PubChem CID 5118200) has the molecular formula C29H37BrN2O6 and a molecular weight of 589.53 g/mol. Its IUPAC name is 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[(3-butoxyphenyl)-hydroxymethylidene]-1-[3-(diethylamino)propyl]pyrrolidine-2,3-dione.
| Compound Name | 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[(3-butoxyphenyl)-hydroxymethylidene]-1-[3-(diethylamino)propyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5118200 |
| Molecular Formula | C29H37BrN2O6 |
| Molecular Weight | 589.53 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[(3-butoxyphenyl)-hydroxymethylidene]-1-[3-(diethylamino)propyl]pyrrolidine-2,3-dione |
| SMILES | CCCCOc1cccc(C(O)=C2C(=O)C(=O)N(CCCN(CC)CC)C2c2cc(Br)c(O)c(OC)c2)c1 |
| InChI | InChI=1S/C29H37BrN2O6/c1-5-8-15-38-21-12-9-11-19(16-21)26(33)24-25(20-17-22(30)27(34)23(18-20)37-4)32(29(36)28(24)35)14-10-13-31(6-2)7-3/h9,11-12,16-18,25,33-34H,5-8,10,13-15H2,1-4H3 |
| InChIKey | DPFLMLGMMSKHMQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|