C27H31BrN2O7 — CID 6171332
(4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[(3-ethoxyphenyl)-hydroxymethylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 6171332) has the molecular formula C27H31BrN2O7 and a molecular weight of 575.46 g/mol. Its IUPAC name is (4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[(3-ethoxyphenyl)-hydroxymethylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[(3-ethoxyphenyl)-hydroxymethylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6171332 |
| Molecular Formula | C27H31BrN2O7 |
| Molecular Weight | 575.46 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | (4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[(3-ethoxyphenyl)-hydroxymethylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cccc(/C(O)=C2\C(=O)C(=O)N(CCCN3CCOCC3)C2c2cc(Br)c(O)c(OC)c2)c1 |
| InChI | InChI=1S/C27H31BrN2O7/c1-3-37-19-7-4-6-17(14-19)24(31)22-23(18-15-20(28)25(32)21(16-18)35-2)30(27(34)26(22)33)9-5-8-29-10-12-36-13-11-29/h4,6-7,14-16,23,31-32H,3,5,8-13H2,1-2H3/b24-22+ |
| InChIKey | FSDZZOODNSASKW-ZNTNEXAZSA-N |
| XLogP | 3.71 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|