C41H48F3NO7 — CID 3350734
ethyl N-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate (PubChem CID 3350734) has the molecular formula C41H48F3NO7 and a molecular weight of 723.83 g/mol. Its IUPAC name is ethyl N-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate.
| Compound Name | ethyl N-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 3350734 |
| Molecular Formula | C41H48F3NO7 |
| Molecular Weight | 723.83 g/mol |
| Exact Mass | 723.34 |
| IUPAC Name | ethyl N-[[5,13-dihydroxy-17-(4-methoxybenzoyl)-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]carbamate |
| SMILES | CCOC(=O)N(Cc1ccc(OC(F)(F)F)cc1)CC1(O)CCC2c3ccc(cc3C(=O)c3ccc(OC)cc3)CC(O)CCC(C)=CCCC21C |
| InChI | InChI=1S/C41H48F3NO7/c1-5-51-38(48)45(25-28-9-15-33(16-10-28)52-41(42,43)44)26-40(49)22-20-36-34-19-11-29(23-31(46)14-8-27(2)7-6-21-39(36,40)3)24-35(34)37(47)30-12-17-32(50-4)18-13-30/h7,9-13,15-19,24,31,36,46,49H,5-6,8,14,20-23,25-26H2,1-4H3 |
| InChIKey | QETSIKKTQXZFJZ-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.83 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|