C23H26N2O — CID 3352723
1-(2-adamantyl)-3-(4-phenylphenyl)urea (PubChem CID 3352723) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-(2-adamantyl)-3-(4-phenylphenyl)urea.
| Compound Name | 1-(2-adamantyl)-3-(4-phenylphenyl)urea |
|---|---|
| PubChem CID | 3352723 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1-(2-adamantyl)-3-(4-phenylphenyl)urea |
| SMILES | O=C(Nc1ccc(-c2ccccc2)cc1)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C23H26N2O/c26-23(25-22-19-11-15-10-16(13-19)14-20(22)12-15)24-21-8-6-18(7-9-21)17-4-2-1-3-5-17/h1-9,15-16,19-20,22H,10-14H2,(H2,24,25,26) |
| InChIKey | CAWVICLYDLMXPU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |