C17H23N3O6S — CID 3353616
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate (PubChem CID 3353616) has the molecular formula C17H23N3O6S and a molecular weight of 397.45 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 3353616 |
| Molecular Formula | C17H23N3O6S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-[(4-methylphenyl)sulfonylamino]acetate |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)OCC(=O)NC(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C17H23N3O6S/c1-12-6-8-14(9-7-12)27(24,25)18-10-16(22)26-11-15(21)20-17(23)19-13-4-2-3-5-13/h6-9,13,18H,2-5,10-11H2,1H3,(H2,19,20,21,23) |
| InChIKey | FKEYUOJLMDDZBU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |